C38H36N4O6 — CID 132942520
7,18-bis(3-hydroxypropyl)-11,22-dipyrrolidin-1-yl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone (PubChem CID 132942520) has the molecular formula C38H36N4O6 and a molecular weight of 644.73 g/mol. Its IUPAC name is 7,18-bis(3-hydroxypropyl)-11,22-dipyrrolidin-1-yl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7,18-bis(3-hydroxypropyl)-11,22-dipyrrolidin-1-yl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 132942520 |
| Molecular Formula | C38H36N4O6 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 7,18-bis(3-hydroxypropyl)-11,22-dipyrrolidin-1-yl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
| SMILES | O=C1c2ccc3c4c(N5CCCC5)cc5c6c(ccc(c7c(N8CCCC8)cc(c2c37)C(=O)N1CCCO)c64)C(=O)N(CCCO)C5=O |
| InChI | InChI=1S/C38H36N4O6/c43-17-5-15-41-35(45)23-10-8-22-32-28(40-13-3-4-14-40)20-26-30-24(36(46)42(38(26)48)16-6-18-44)9-7-21(34(30)32)31-27(39-11-1-2-12-39)19-25(37(41)47)29(23)33(22)31/h7-10,19-20,43-44H,1-6,11-18H2 |
| InChIKey | AVIDKSSGZQDSRO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|