C22H17F3N2O — CID 12000846
1-benzyl-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinazolin-2-one (PubChem CID 12000846) has the molecular formula C22H17F3N2O and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-benzyl-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinazolin-2-one.
| Compound Name | 1-benzyl-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 12000846 |
| Molecular Formula | C22H17F3N2O |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-benzyl-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinazolin-2-one |
| SMILES | O=C1NCc2cc(-c3ccc(C(F)(F)F)cc3)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H17F3N2O/c23-22(24,25)19-9-6-16(7-10-19)17-8-11-20-18(12-17)13-26-21(28)27(20)14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,26,28) |
| InChIKey | AEIQAWHFJHBATF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |