C31H20BrNO4 — CID 58527715
5-bromo-20-methoxy-16-(3-methoxy-5-methylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 58527715) has the molecular formula C31H20BrNO4 and a molecular weight of 550.41 g/mol. Its IUPAC name is 5-bromo-20-methoxy-16-(3-methoxy-5-methylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 5-bromo-20-methoxy-16-(3-methoxy-5-methylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 58527715 |
| Molecular Formula | C31H20BrNO4 |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 5-bromo-20-methoxy-16-(3-methoxy-5-methylphenyl)-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | COc1cc(C)cc(N2C(=O)c3ccc4c5cccc6c(Br)ccc(c7c(OC)cc(c3c47)C2=O)c65)c1 |
| InChI | InChI=1S/C31H20BrNO4/c1-15-11-16(13-17(12-15)36-2)33-30(34)22-8-7-19-18-5-4-6-20-24(32)10-9-21(26(18)20)28-25(37-3)14-23(31(33)35)27(22)29(19)28/h4-14H,1-3H3 |
| InChIKey | WKYGFIQVVIZSMB-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|