C11H10N2O5 — CID 112577479
4-(carboxymethyl)-2-oxo-1,3-dihydroquinoxaline-5-carboxylic acid (PubChem CID 112577479) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 4-(carboxymethyl)-2-oxo-1,3-dihydroquinoxaline-5-carboxylic acid.
| Compound Name | 4-(carboxymethyl)-2-oxo-1,3-dihydroquinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 112577479 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-(carboxymethyl)-2-oxo-1,3-dihydroquinoxaline-5-carboxylic acid |
| SMILES | O=C(O)CN1CC(=O)Nc2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C11H10N2O5/c14-8-4-13(5-9(15)16)10-6(11(17)18)2-1-3-7(10)12-8/h1-3H,4-5H2,(H,12,14)(H,15,16)(H,17,18) |
| InChIKey | JXLZXPZAJGSZJC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |