C14H19N3O3 — CID 115935018
methyl 3-amino-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzoate (PubChem CID 115935018) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is methyl 3-amino-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzoate.
| Compound Name | methyl 3-amino-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 115935018 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | methyl 3-amino-2-(2,2-dimethyl-3-oxopiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1cccc(N)c1N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C14H19N3O3/c1-14(2)13(19)16-7-8-17(14)11-9(12(18)20-3)5-4-6-10(11)15/h4-6H,7-8,15H2,1-3H3,(H,16,19) |
| InChIKey | CJALZQDYFOBCQF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|