C15H20N2O4 — CID 115935418
methyl 3-amino-2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzoate (PubChem CID 115935418) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl 3-amino-2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzoate.
| Compound Name | methyl 3-amino-2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzoate |
|---|---|
| PubChem CID | 115935418 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 3-amino-2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzoate |
| SMILES | COC(=O)c1cccc(N)c1N1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C15H20N2O4/c1-19-14(18)11-4-2-5-12(16)13(11)17-7-3-6-15(10-17)20-8-9-21-15/h2,4-5H,3,6-10,16H2,1H3 |
| InChIKey | MOPAMRPBDSZUPH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|