C13H18N4O3S — CID 103194559
2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzenesulfonamide (PubChem CID 103194559) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzenesulfonamide.
| Compound Name | 2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103194559 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-amino-3-(5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)benzenesulfonamide |
| SMILES | Nc1c(N2CCCC3C(=O)NCC32)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H18N4O3S/c14-12-9(4-1-5-11(12)21(15,19)20)17-6-2-3-8-10(17)7-16-13(8)18/h1,4-5,8,10H,2-3,6-7,14H2,(H,16,18)(H2,15,19,20) |
| InChIKey | HEFUKIHXMBWXAR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|