C18H21NO4S3 — CID 55617034
N-(2-cyclopentylsulfanylphenyl)-2-methylsulfonylbenzenesulfonamide (PubChem CID 55617034) has the molecular formula C18H21NO4S3 and a molecular weight of 411.57 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55617034 |
| Molecular Formula | C18H21NO4S3 |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-2-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)Nc1ccccc1SC1CCCC1 |
| InChI | InChI=1S/C18H21NO4S3/c1-25(20,21)17-12-6-7-13-18(17)26(22,23)19-15-10-4-5-11-16(15)24-14-8-2-3-9-14/h4-7,10-14,19H,2-3,8-9H2,1H3 |
| InChIKey | COZVOEIPWQTXTQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |