C19H23NO4S2 — CID 55617061
N-(2-cyclopentylsulfanylphenyl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 55617061) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 55617061 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccccc2SC2CCCC2)c1 |
| InChI | InChI=1S/C19H23NO4S2/c1-23-14-11-12-17(24-2)19(13-14)26(21,22)20-16-9-5-6-10-18(16)25-15-7-3-4-8-15/h5-6,9-13,15,20H,3-4,7-8H2,1-2H3 |
| InChIKey | KBGKVUMPTGZYEW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |