C17H25NO3S2 — CID 52515319
(2R)-N-(4-cyclohexylsulfanyl-2-methylphenyl)-2-methylsulfonylpropanamide (PubChem CID 52515319) has the molecular formula C17H25NO3S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is (2R)-N-(4-cyclohexylsulfanyl-2-methylphenyl)-2-methylsulfonylpropanamide.
| Compound Name | (2R)-N-(4-cyclohexylsulfanyl-2-methylphenyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 52515319 |
| Molecular Formula | C17H25NO3S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (2R)-N-(4-cyclohexylsulfanyl-2-methylphenyl)-2-methylsulfonylpropanamide |
| SMILES | Cc1cc(SC2CCCCC2)ccc1NC(=O)[C@@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C17H25NO3S2/c1-12-11-15(22-14-7-5-4-6-8-14)9-10-16(12)18-17(19)13(2)23(3,20)21/h9-11,13-14H,4-8H2,1-3H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | ZCGDHERTAXOYSB-CYBMUJFWSA-N |
| XLogP | 3.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |