C21H26N4O4S — CID 166330543
methyl 3-[[2-(4-cyclohexylsulfanyl-2-methylanilino)-2-oxoacetyl]amino]-1-methylpyrazole-5-carboxylate (PubChem CID 166330543) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is methyl 3-[[2-(4-cyclohexylsulfanyl-2-methylanilino)-2-oxoacetyl]amino]-1-methylpyrazole-5-carboxylate.
| Compound Name | methyl 3-[[2-(4-cyclohexylsulfanyl-2-methylanilino)-2-oxoacetyl]amino]-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 166330543 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | methyl 3-[[2-(4-cyclohexylsulfanyl-2-methylanilino)-2-oxoacetyl]amino]-1-methylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C(=O)Nc2ccc(SC3CCCCC3)cc2C)nn1C |
| InChI | InChI=1S/C21H26N4O4S/c1-13-11-15(30-14-7-5-4-6-8-14)9-10-16(13)22-19(26)20(27)23-18-12-17(21(28)29-3)25(2)24-18/h9-12,14H,4-8H2,1-3H3,(H,22,26)(H,23,24,27) |
| InChIKey | QJVQBQOVDQMCBT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|