C13H14N4O4 — CID 166330492
methyl 1-methyl-3-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazole-5-carboxylate (PubChem CID 166330492) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 1-methyl-3-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-3-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 166330492 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methyl 1-methyl-3-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(C)[nH]c2=O)nn1C |
| InChI | InChI=1S/C13H14N4O4/c1-7-4-5-8(11(18)14-7)12(19)15-10-6-9(13(20)21-3)17(2)16-10/h4-6H,1-3H3,(H,14,18)(H,15,16,19) |
| InChIKey | KXDZYLIFRNVEOF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |