C17H27NO3S2 — CID 52510301
(2R)-N-[4-[(2S)-butan-2-yl]sulfanyl-2-methylphenyl]-2-propan-2-ylsulfonylpropanamide (PubChem CID 52510301) has the molecular formula C17H27NO3S2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (2R)-N-[4-[(2S)-butan-2-yl]sulfanyl-2-methylphenyl]-2-propan-2-ylsulfonylpropanamide.
| Compound Name | (2R)-N-[4-[(2S)-butan-2-yl]sulfanyl-2-methylphenyl]-2-propan-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 52510301 |
| Molecular Formula | C17H27NO3S2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2R)-N-[4-[(2S)-butan-2-yl]sulfanyl-2-methylphenyl]-2-propan-2-ylsulfonylpropanamide |
| SMILES | CC[C@H](C)Sc1ccc(NC(=O)[C@@H](C)S(=O)(=O)C(C)C)c(C)c1 |
| InChI | InChI=1S/C17H27NO3S2/c1-7-13(5)22-15-8-9-16(12(4)10-15)18-17(19)14(6)23(20,21)11(2)3/h8-11,13-14H,7H2,1-6H3,(H,18,19)/t13-,14+/m0/s1 |
| InChIKey | NUDUXOQTGULKGT-UONOGXRCSA-N |
| XLogP | 4.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |