C22H29N3O3S — CID 102562782
methyl 3-[(4-tert-butylsulfanyl-2-methylphenyl)carbamoylamino]-3-pyridin-4-ylbutanoate (PubChem CID 102562782) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is methyl 3-[(4-tert-butylsulfanyl-2-methylphenyl)carbamoylamino]-3-pyridin-4-ylbutanoate.
| Compound Name | methyl 3-[(4-tert-butylsulfanyl-2-methylphenyl)carbamoylamino]-3-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 102562782 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | methyl 3-[(4-tert-butylsulfanyl-2-methylphenyl)carbamoylamino]-3-pyridin-4-ylbutanoate |
| SMILES | COC(=O)CC(C)(NC(=O)Nc1ccc(SC(C)(C)C)cc1C)c1ccncc1 |
| InChI | InChI=1S/C22H29N3O3S/c1-15-13-17(29-21(2,3)4)7-8-18(15)24-20(27)25-22(5,14-19(26)28-6)16-9-11-23-12-10-16/h7-13H,14H2,1-6H3,(H2,24,25,27) |
| InChIKey | ZVXGAVBJPUPGEI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |