C17H26N2O2S — CID 95330022
(3R)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-hydroxypiperidine-1-carboxamide (PubChem CID 95330022) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is (3R)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-hydroxypiperidine-1-carboxamide.
| Compound Name | (3R)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 95330022 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (3R)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-hydroxypiperidine-1-carboxamide |
| SMILES | Cc1cc(SC(C)(C)C)ccc1NC(=O)N1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C17H26N2O2S/c1-12-10-14(22-17(2,3)4)7-8-15(12)18-16(21)19-9-5-6-13(20)11-19/h7-8,10,13,20H,5-6,9,11H2,1-4H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | YZVFFHYFJFQVQO-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |