C18H23F3N4O2 — CID 97311916
1-[(3R)-2-oxoazepan-3-yl]-3-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]urea (PubChem CID 97311916) has the molecular formula C18H23F3N4O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is 1-[(3R)-2-oxoazepan-3-yl]-3-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3R)-2-oxoazepan-3-yl]-3-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 97311916 |
| Molecular Formula | C18H23F3N4O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[(3R)-2-oxoazepan-3-yl]-3-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCCC1)N[C@@H]1CCCCNC1=O |
| InChI | InChI=1S/C18H23F3N4O2/c19-18(20,21)12-6-7-15(25-9-3-4-10-25)14(11-12)24-17(27)23-13-5-1-2-8-22-16(13)26/h6-7,11,13H,1-5,8-10H2,(H,22,26)(H2,23,24,27)/t13-/m1/s1 |
| InChIKey | NGKVLLLIDHIMQD-CYBMUJFWSA-N |
| XLogP | 3.10 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |