C22H28F3N5O3 — CID 145268895
1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one (PubChem CID 145268895) has the molecular formula C22H28F3N5O3 and a molecular weight of 467.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one.
| Compound Name | 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 145268895 |
| Molecular Formula | C22H28F3N5O3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCOCC1)NC1CCCCC1.O=c1nccc[nH]1 |
| InChI | InChI=1S/C18H24F3N3O2.C4H4N2O/c19-18(20,21)13-6-7-16(24-8-10-26-11-9-24)15(12-13)23-17(25)22-14-4-2-1-3-5-14;7-4-5-2-1-3-6-4/h6-7,12,14H,1-5,8-11H2,(H2,22,23,25);1-3H,(H,5,6,7) |
| InChIKey | IPIXASHKRPCFIP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |