About 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one
1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one (PubChem CID 145268895) has the molecular formula C22H28F3N5O3
and a molecular weight of 467.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one |
| PubChem CID | 145268895 |
| Molecular Formula | C22H28F3N5O3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1N1CCOCC1)NC1CCCCC1.O=c1nccc[nH]1 |
| InChI | InChI=1S/C18H24F3N3O2.C4H4N2O/c19-18(20,21)13-6-7-16(24-8-10-26-11-9-24)15(12-13)23-17(25)22-14-4-2-1-3-5-14;7-4-5-2-1-3-6-4/h6-7,12,14H,1-5,8-11H2,(H2,22,23,25);1-3H,(H,5,6,7) |
| InChIKey | IPIXASHKRPCFIP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one?
The IUPAC name of 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one (CID 145268895) is 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one.
What is the SMILES notation for 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one?
The canonical SMILES for 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one is O=C(Nc1cc(C(F)(F)F)ccc1N1CCOCC1)NC1CCCCC1.O=c1nccc[nH]1.
What is the InChIKey of 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one?
The InChIKey is IPIXASHKRPCFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F3N3O2.C4H4N2O/c19-18(20,21)13-6-7-16(24-8-10-26-11-9-24)15(12-13)23-17(25)22-14-4-2-1-3-5-14;7-4-5-2-1-3-6-4/h6-7,12,14H,1-5,8-11H2,(H2,22,23,25);1-3H,(H,5,6,7).
What are the key properties of 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one?
1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one has a molecular weight of 467.49 g/mol, XLogP of 3.77, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]urea;1H-pyrimidin-2-one is sourced from PubChem (CID 145268895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).