C16H16FN3O2 — CID 96999764
1-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]-3-(2-methoxy-3-pyridinyl)urea (PubChem CID 96999764) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]-3-(2-methoxy-3-pyridinyl)urea.
| Compound Name | 1-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]-3-(2-methoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 96999764 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]-3-(2-methoxy-3-pyridinyl)urea |
| SMILES | COc1ncccc1NC(=O)N[C@H]1C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FN3O2/c1-22-15-13(3-2-8-18-15)19-16(21)20-14-9-12(14)10-4-6-11(17)7-5-10/h2-8,12,14H,9H2,1H3,(H2,19,20,21)/t12-,14-/m0/s1 |
| InChIKey | VSWLJWYQPNOZFW-JSGCOSHPSA-N |
| XLogP | 2.91 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |