C18H19N3O4 — CID 95307616
N-[(1S,2S)-2-(2-methoxyphenyl)cyclopropyl]-N'-(2-methoxy-3-pyridinyl)oxamide (PubChem CID 95307616) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[(1S,2S)-2-(2-methoxyphenyl)cyclopropyl]-N'-(2-methoxy-3-pyridinyl)oxamide.
| Compound Name | N-[(1S,2S)-2-(2-methoxyphenyl)cyclopropyl]-N'-(2-methoxy-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 95307616 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[(1S,2S)-2-(2-methoxyphenyl)cyclopropyl]-N'-(2-methoxy-3-pyridinyl)oxamide |
| SMILES | COc1ccccc1[C@@H]1C[C@@H]1NC(=O)C(=O)Nc1cccnc1OC |
| InChI | InChI=1S/C18H19N3O4/c1-24-15-8-4-3-6-11(15)12-10-14(12)21-17(23)16(22)20-13-7-5-9-19-18(13)25-2/h3-9,12,14H,10H2,1-2H3,(H,20,22)(H,21,23)/t12-,14-/m0/s1 |
| InChIKey | XCHVDKXGMHYPBF-JSGCOSHPSA-N |
| XLogP | 1.71 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|