C19H20N2O3 — CID 95300072
N-[(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-N'-(2-methylphenyl)oxamide (PubChem CID 95300072) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-N'-(2-methylphenyl)oxamide.
| Compound Name | N-[(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 95300072 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[(1S,2S)-2-(4-methoxyphenyl)cyclopropyl]-N'-(2-methylphenyl)oxamide |
| SMILES | COc1ccc([C@@H]2C[C@@H]2NC(=O)C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-12-5-3-4-6-16(12)20-18(22)19(23)21-17-11-15(17)13-7-9-14(24-2)10-8-13/h3-10,15,17H,11H2,1-2H3,(H,20,22)(H,21,23)/t15-,17-/m0/s1 |
| InChIKey | RVBFNARMDJUHIS-RDJZCZTQSA-N |
| XLogP | 2.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|