About 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea
3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea (PubChem CID 95322792) has the molecular formula C18H21N3O2
and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea.
Molecular Properties
| Compound Name | 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea |
| PubChem CID | 95322792 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea |
| SMILES | COc1ccccc1[C@H]1C[C@@H]1NC(=O)N(C)Cc1ccncc1 |
| InChI | InChI=1S/C18H21N3O2/c1-21(12-13-7-9-19-10-8-13)18(22)20-16-11-15(16)14-5-3-4-6-17(14)23-2/h3-10,15-16H,11-12H2,1-2H3,(H,20,22)/t15-,16+/m1/s1 |
| InChIKey | DQFGCWUWBBMXEB-CVEARBPZSA-N |
| XLogP | 2.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea?
The IUPAC name of 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea (CID 95322792) is 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea.
What is the SMILES notation for 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea?
The canonical SMILES for 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea is COc1ccccc1[C@H]1C[C@@H]1NC(=O)N(C)Cc1ccncc1.
What is the InChIKey of 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea?
The InChIKey is DQFGCWUWBBMXEB-CVEARBPZSA-N. The full InChI is InChI=1S/C18H21N3O2/c1-21(12-13-7-9-19-10-8-13)18(22)20-16-11-15(16)14-5-3-4-6-17(14)23-2/h3-10,15-16H,11-12H2,1-2H3,(H,20,22)/t15-,16+/m1/s1.
What are the key properties of 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea?
3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea has a molecular weight of 311.38 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2R)-2-(2-methoxyphenyl)cyclopropyl]-1-methyl-1-(pyridin-4-ylmethyl)urea is sourced from PubChem (CID 95322792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).