C16H19F3N2O3 — CID 75440536
methyl 2-[[3-(trifluoromethyl)pyridine-2-carbonyl]amino]cycloheptane-1-carboxylate (PubChem CID 75440536) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is methyl 2-[[3-(trifluoromethyl)pyridine-2-carbonyl]amino]cycloheptane-1-carboxylate.
| Compound Name | methyl 2-[[3-(trifluoromethyl)pyridine-2-carbonyl]amino]cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 75440536 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 2-[[3-(trifluoromethyl)pyridine-2-carbonyl]amino]cycloheptane-1-carboxylate |
| SMILES | COC(=O)C1CCCCCC1NC(=O)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O3/c1-24-15(23)10-6-3-2-4-8-12(10)21-14(22)13-11(16(17,18)19)7-5-9-20-13/h5,7,9-10,12H,2-4,6,8H2,1H3,(H,21,22) |
| InChIKey | SZFLOJSGPBCGRE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |