C9H11F3N2O3 — CID 162621627
methoxymethanamine;3-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 162621627) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is methoxymethanamine;3-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | methoxymethanamine;3-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 162621627 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | methoxymethanamine;3-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | COCN.O=C(O)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C7H4F3NO2.C2H7NO/c8-7(9,10)4-2-1-3-11-5(4)6(12)13;1-4-2-3/h1-3H,(H,12,13);2-3H2,1H3 |
| InChIKey | MQNUNRSNWWIEDU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|