C16H14F3N3O3 — CID 75398752
N'-(4-ethoxybenzoyl)-3-(trifluoromethyl)pyridine-2-carbohydrazide (PubChem CID 75398752) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is N'-(4-ethoxybenzoyl)-3-(trifluoromethyl)pyridine-2-carbohydrazide.
| Compound Name | N'-(4-ethoxybenzoyl)-3-(trifluoromethyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 75398752 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N'-(4-ethoxybenzoyl)-3-(trifluoromethyl)pyridine-2-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ncccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3N3O3/c1-2-25-11-7-5-10(6-8-11)14(23)21-22-15(24)13-12(16(17,18)19)4-3-9-20-13/h3-9H,2H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | IONIBBSOEFRAPD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|