C13H15F3N2O4 — CID 86990376
4-ethoxy-N'-[2-(2,2,2-trifluoroethoxy)acetyl]benzohydrazide (PubChem CID 86990376) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is 4-ethoxy-N'-[2-(2,2,2-trifluoroethoxy)acetyl]benzohydrazide.
| Compound Name | 4-ethoxy-N'-[2-(2,2,2-trifluoroethoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 86990376 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-ethoxy-N'-[2-(2,2,2-trifluoroethoxy)acetyl]benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2O4/c1-2-22-10-5-3-9(4-6-10)12(20)18-17-11(19)7-21-8-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | LNJGIJJAAMGKFY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|