C17H17N3O4S — CID 133387471
4-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-ylamino)-3-nitrobenzenesulfonamide (PubChem CID 133387471) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-ylamino)-3-nitrobenzenesulfonamide.
| Compound Name | 4-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-ylamino)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133387471 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-(1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-ylamino)-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC2C3CCc4ccccc4C32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N3O4S/c18-25(23,24)11-6-8-14(15(9-11)20(21)22)19-17-13-7-5-10-3-1-2-4-12(10)16(13)17/h1-4,6,8-9,13,16-17,19H,5,7H2,(H2,18,23,24) |
| InChIKey | DUEZNGSYWXIFDC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|