C17H16N2O4S — CID 124861827
(1R,1aS,6aR)-N-(2-methylsulfonyl-4-nitrophenyl)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-amine (PubChem CID 124861827) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is (1R,1aS,6aR)-N-(2-methylsulfonyl-4-nitrophenyl)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-amine.
| Compound Name | (1R,1aS,6aR)-N-(2-methylsulfonyl-4-nitrophenyl)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-amine |
|---|---|
| PubChem CID | 124861827 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (1R,1aS,6aR)-N-(2-methylsulfonyl-4-nitrophenyl)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])ccc1N[C@@H]1[C@@H]2Cc3ccccc3[C@H]21 |
| InChI | InChI=1S/C17H16N2O4S/c1-24(22,23)15-9-11(19(20)21)6-7-14(15)18-17-13-8-10-4-2-3-5-12(10)16(13)17/h2-7,9,13,16-18H,8H2,1H3/t13-,16-,17-/m1/s1 |
| InChIKey | JVDIDQUKWIFDCW-KBRIMQKVSA-N |
| XLogP | 2.75 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|