C18H19NO2 — CID 43679244
methyl 2-(2,3-dihydro-1H-inden-1-ylamino)-5-methylbenzoate (PubChem CID 43679244) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-inden-1-ylamino)-5-methylbenzoate.
| Compound Name | methyl 2-(2,3-dihydro-1H-inden-1-ylamino)-5-methylbenzoate |
|---|---|
| PubChem CID | 43679244 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-inden-1-ylamino)-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)ccc1NC1CCc2ccccc21 |
| InChI | InChI=1S/C18H19NO2/c1-12-7-9-17(15(11-12)18(20)21-2)19-16-10-8-13-5-3-4-6-14(13)16/h3-7,9,11,16,19H,8,10H2,1-2H3 |
| InChIKey | FHLXHCWNMKQZLH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |