C12H16FNS — CID 117202070
3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine (PubChem CID 117202070) has the molecular formula C12H16FNS and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 117202070 |
| Molecular Formula | C12H16FNS |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1CSc2ccc(F)cc21 |
| InChI | InChI=1S/C12H16FNS/c1-14-6-2-3-9-8-15-12-5-4-10(13)7-11(9)12/h4-5,7,9,14H,2-3,6,8H2,1H3 |
| InChIKey | MPZJEBKNQIIXTE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|