About 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine
3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine (PubChem CID 117202070) has the molecular formula C12H16FNS
and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine |
| PubChem CID | 117202070 |
| Molecular Formula | C12H16FNS |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCC1CSc2ccc(F)cc21 |
| InChI | InChI=1S/C12H16FNS/c1-14-6-2-3-9-8-15-12-5-4-10(13)7-11(9)12/h4-5,7,9,14H,2-3,6,8H2,1H3 |
| InChIKey | MPZJEBKNQIIXTE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine?
The IUPAC name of 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine (CID 117202070) is 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine.
What is the SMILES notation for 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine?
The canonical SMILES for 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine is CNCCCC1CSc2ccc(F)cc21.
What is the InChIKey of 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine?
The InChIKey is MPZJEBKNQIIXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNS/c1-14-6-2-3-9-8-15-12-5-4-10(13)7-11(9)12/h4-5,7,9,14H,2-3,6,8H2,1H3.
What are the key properties of 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine?
3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine has a molecular weight of 225.33 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)-N-methylpropan-1-amine is sourced from PubChem (CID 117202070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).