About 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid
5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid (PubChem CID 83908153) has the molecular formula C9H7FO2S
and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid.
Analyze 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid (CID 83908153) is 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid is O=C(O)C1CSc2ccc(F)cc21.
What is the InChIKey of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The InChIKey is VTSUXUZICXRANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-3,7H,4H2,(H,11,12).
What are the key properties of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid has a molecular weight of 198.22 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 83908153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).