5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid

C9H7FO2S — CID 83908153

IUPAC5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid
SMILESO=C(O)C1CSc2ccc(F)cc21
InChIInChI=1S/C9H7FO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-3,7H,4H2,(H,11,12)
InChIKeyVTSUXUZICXRANW-UHFFFAOYSA-N
MW198.22 g/mol
LogP2.10
Rot. Bonds1

About 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid

5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid (PubChem CID 83908153) has the molecular formula C9H7FO2S and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid.

Molecular Properties

Compound Name5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid
PubChem CID83908153
Molecular FormulaC9H7FO2S
Molecular Weight198.22 g/mol
Exact Mass198.02
IUPAC Name5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid
SMILESO=C(O)C1CSc2ccc(F)cc21
InChIInChI=1S/C9H7FO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-3,7H,4H2,(H,11,12)
InChIKeyVTSUXUZICXRANW-UHFFFAOYSA-N
XLogP2.10
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 52.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid (CID 83908153) is 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid is O=C(O)C1CSc2ccc(F)cc21.
What is the InChIKey of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The InChIKey is VTSUXUZICXRANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-3,7H,4H2,(H,11,12).
What are the key properties of 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid has a molecular weight of 198.22 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dihydro-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 83908153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).