5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid

C9H7BrO2S — CID 83913289

IUPAC5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid
SMILESO=C(O)C1CSc2ccc(Br)cc21
InChIInChI=1S/C9H7BrO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-3,7H,4H2,(H,11,12)
InChIKeyICCMRGAKFMVWKF-UHFFFAOYSA-N
MW259.12 g/mol
LogP2.72
Rot. Bonds1

About 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid

5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid (PubChem CID 83913289) has the molecular formula C9H7BrO2S and a molecular weight of 259.12 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid.

Molecular Properties

Compound Name5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid
PubChem CID83913289
Molecular FormulaC9H7BrO2S
Molecular Weight259.12 g/mol
Exact Mass257.94
IUPAC Name5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid
SMILESO=C(O)C1CSc2ccc(Br)cc21
InChIInChI=1S/C9H7BrO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-3,7H,4H2,(H,11,12)
InChIKeyICCMRGAKFMVWKF-UHFFFAOYSA-N
XLogP2.72
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.12
LogP ≤ 52.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid (CID 83913289) is 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid is O=C(O)C1CSc2ccc(Br)cc21.
What is the InChIKey of 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The InChIKey is ICCMRGAKFMVWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-3,7H,4H2,(H,11,12).
What are the key properties of 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid has a molecular weight of 259.12 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3-dihydro-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 83913289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).