About (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine
(5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine (PubChem CID 83912845) has the molecular formula C9H10BrNS
and a molecular weight of 244.16 g/mol. Its IUPAC name is (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine.
Analyze (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine?
The IUPAC name of (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine (CID 83912845) is (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine.
What is the SMILES notation for (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine?
The canonical SMILES for (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine is NCC1CSc2ccc(Br)cc21.
What is the InChIKey of (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine?
The InChIKey is VFHUIVQYWMGXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNS/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-3,6H,4-5,11H2.
What are the key properties of (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine?
(5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine has a molecular weight of 244.16 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2,3-dihydro-1-benzothiophen-3-yl)methanamine is sourced from PubChem (CID 83912845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).