C9H10BrNS — CID 53408397
6-bromo-3,4-dihydro-2H-thiochromen-3-amine (PubChem CID 53408397) has the molecular formula C9H10BrNS and a molecular weight of 244.16 g/mol. Its IUPAC name is 6-bromo-3,4-dihydro-2H-thiochromen-3-amine.
| Compound Name | 6-bromo-3,4-dihydro-2H-thiochromen-3-amine |
|---|---|
| PubChem CID | 53408397 |
| Molecular Formula | C9H10BrNS |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 6-bromo-3,4-dihydro-2H-thiochromen-3-amine |
| SMILES | NC1CSc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C9H10BrNS/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-3,8H,4-5,11H2 |
| InChIKey | LJWRGYCUPKZNCC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |