C10H12ClNS — CID 82394109
(6-chloro-3,4-dihydro-2H-thiochromen-3-yl)methanamine (PubChem CID 82394109) has the molecular formula C10H12ClNS and a molecular weight of 213.73 g/mol. Its IUPAC name is (6-chloro-3,4-dihydro-2H-thiochromen-3-yl)methanamine.
| Compound Name | (6-chloro-3,4-dihydro-2H-thiochromen-3-yl)methanamine |
|---|---|
| PubChem CID | 82394109 |
| Molecular Formula | C10H12ClNS |
| Molecular Weight | 213.73 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | (6-chloro-3,4-dihydro-2H-thiochromen-3-yl)methanamine |
| SMILES | NCC1CSc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C10H12ClNS/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-2,4,7H,3,5-6,12H2 |
| InChIKey | WWRPLUOTUZNXDT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |