C9H10BrNS — CID 122538323
6-bromo-3-methyl-3,4-dihydro-2H-1,2-benzothiazine (PubChem CID 122538323) has the molecular formula C9H10BrNS and a molecular weight of 244.16 g/mol. Its IUPAC name is 6-bromo-3-methyl-3,4-dihydro-2H-1,2-benzothiazine.
| Compound Name | 6-bromo-3-methyl-3,4-dihydro-2H-1,2-benzothiazine |
|---|---|
| PubChem CID | 122538323 |
| Molecular Formula | C9H10BrNS |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 6-bromo-3-methyl-3,4-dihydro-2H-1,2-benzothiazine |
| SMILES | CC1Cc2cc(Br)ccc2SN1 |
| InChI | InChI=1S/C9H10BrNS/c1-6-4-7-5-8(10)2-3-9(7)12-11-6/h2-3,5-6,11H,4H2,1H3 |
| InChIKey | NAKPVLQUQYYRRW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|