C10H12BrNS — CID 118170492
7-bromo-4-methyl-2,3,4,5-tetrahydro-1,2-benzothiazepine (PubChem CID 118170492) has the molecular formula C10H12BrNS and a molecular weight of 258.18 g/mol. Its IUPAC name is 7-bromo-4-methyl-2,3,4,5-tetrahydro-1,2-benzothiazepine.
| Compound Name | 7-bromo-4-methyl-2,3,4,5-tetrahydro-1,2-benzothiazepine |
|---|---|
| PubChem CID | 118170492 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 7-bromo-4-methyl-2,3,4,5-tetrahydro-1,2-benzothiazepine |
| SMILES | CC1CNSc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C10H12BrNS/c1-7-4-8-5-9(11)2-3-10(8)13-12-6-7/h2-3,5,7,12H,4,6H2,1H3 |
| InChIKey | IROLMQHHXJWZJT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|