C12H14F3NS — CID 135123550
(4S)-4-ethyl-7-(trifluoromethyl)-2,3,4,5-tetrahydro-1,2-benzothiazepine (PubChem CID 135123550) has the molecular formula C12H14F3NS and a molecular weight of 261.31 g/mol. Its IUPAC name is (4S)-4-ethyl-7-(trifluoromethyl)-2,3,4,5-tetrahydro-1,2-benzothiazepine.
| Compound Name | (4S)-4-ethyl-7-(trifluoromethyl)-2,3,4,5-tetrahydro-1,2-benzothiazepine |
|---|---|
| PubChem CID | 135123550 |
| Molecular Formula | C12H14F3NS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (4S)-4-ethyl-7-(trifluoromethyl)-2,3,4,5-tetrahydro-1,2-benzothiazepine |
| SMILES | CC[C@@H]1CNSc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C12H14F3NS/c1-2-8-5-9-6-10(12(13,14)15)3-4-11(9)17-16-7-8/h3-4,6,8,16H,2,5,7H2,1H3/t8-/m0/s1 |
| InChIKey | QTRGGDRBMPSZAJ-QMMMGPOBSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|