C10H12BrNS — CID 117201009
1-(5-bromo-2,3-dihydro-1-benzothiophen-2-yl)ethanamine (PubChem CID 117201009) has the molecular formula C10H12BrNS and a molecular weight of 258.18 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dihydro-1-benzothiophen-2-yl)ethanamine.
| Compound Name | 1-(5-bromo-2,3-dihydro-1-benzothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 117201009 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 1-(5-bromo-2,3-dihydro-1-benzothiophen-2-yl)ethanamine |
| SMILES | CC(N)C1Cc2cc(Br)ccc2S1 |
| InChI | InChI=1S/C10H12BrNS/c1-6(12)10-5-7-4-8(11)2-3-9(7)13-10/h2-4,6,10H,5,12H2,1H3 |
| InChIKey | LDLMQZVXJIZFBZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |