About 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid
8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid (PubChem CID 82247533) has the molecular formula C11H11BrO3
and a molecular weight of 271.11 g/mol. Its IUPAC name is 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid.
Analyze 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid?
The IUPAC name of 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid (CID 82247533) is 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid.
What is the SMILES notation for 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid?
The canonical SMILES for 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid is O=C(O)C1CCCOc2cc(Br)ccc21.
What is the InChIKey of 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid?
The InChIKey is DIXUTFGIEOXQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3/c12-7-3-4-8-9(11(13)14)2-1-5-15-10(8)6-7/h3-4,6,9H,1-2,5H2,(H,13,14).
What are the key properties of 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid?
8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid has a molecular weight of 271.11 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,3,4,5-tetrahydro-1-benzoxepine-5-carboxylic acid is sourced from PubChem (CID 82247533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).