C16H15BrINO — CID 43773279
8-bromo-N-(4-iodophenyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 43773279) has the molecular formula C16H15BrINO and a molecular weight of 444.11 g/mol. Its IUPAC name is 8-bromo-N-(4-iodophenyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | 8-bromo-N-(4-iodophenyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 43773279 |
| Molecular Formula | C16H15BrINO |
| Molecular Weight | 444.11 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 8-bromo-N-(4-iodophenyl)-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | Brc1ccc2c(c1)OCCCC2Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H15BrINO/c17-11-3-8-14-15(2-1-9-20-16(14)10-11)19-13-6-4-12(18)5-7-13/h3-8,10,15,19H,1-2,9H2 |
| InChIKey | PUXMLOSJIOJMAY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.11 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|