C16H13ClN2O2 — CID 43732708
5-chloro-3-(2,3-dihydro-1-benzofuran-5-ylamino)-1,3-dihydroindol-2-one (PubChem CID 43732708) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 5-chloro-3-(2,3-dihydro-1-benzofuran-5-ylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-(2,3-dihydro-1-benzofuran-5-ylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43732708 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-chloro-3-(2,3-dihydro-1-benzofuran-5-ylamino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1Nc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H13ClN2O2/c17-10-1-3-13-12(8-10)15(16(20)19-13)18-11-2-4-14-9(7-11)5-6-21-14/h1-4,7-8,15,18H,5-6H2,(H,19,20) |
| InChIKey | PVYBEDUAHISYJV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|