C12H12N4O — CID 43534975
3-[(1-methylpyrazol-4-yl)amino]-1,3-dihydroindol-2-one (PubChem CID 43534975) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 3-[(1-methylpyrazol-4-yl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 3-[(1-methylpyrazol-4-yl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43534975 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-[(1-methylpyrazol-4-yl)amino]-1,3-dihydroindol-2-one |
| SMILES | Cn1cc(NC2C(=O)Nc3ccccc32)cn1 |
| InChI | InChI=1S/C12H12N4O/c1-16-7-8(6-13-16)14-11-9-4-2-3-5-10(9)15-12(11)17/h2-7,11,14H,1H3,(H,15,17) |
| InChIKey | KIFBIKBLSCUBAX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |