C11H10N2O4S — CID 1359843
methyl 4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate (PubChem CID 1359843) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is methyl 4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate.
| Compound Name | methyl 4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 1359843 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | methyl 4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N[C@H]2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H10N2O4S/c1-17-10(15)6-2-4-7(5-3-6)12-9-8(14)13-11(16)18-9/h2-5,9,12H,1H3,(H,13,14,16)/t9-/m0/s1 |
| InChIKey | ORKJQPIUBQIRGY-VIFPVBQESA-N |
| XLogP | 1.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|