C12H12N2O4S — CID 3151731
ethyl 4-[(2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoate (PubChem CID 3151731) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is ethyl 4-[(2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoate.
| Compound Name | ethyl 4-[(2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoate |
|---|---|
| PubChem CID | 3151731 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | ethyl 4-[(2,4-dioxo-1,3-thiazolidin-5-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C12H12N2O4S/c1-2-18-11(16)7-3-5-8(6-4-7)13-10-9(15)14-12(17)19-10/h3-6,10,13H,2H2,1H3,(H,14,15,17) |
| InChIKey | LPAMRTFDJDDTDM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|