C19H17BrN2O4S — CID 51566662
ethyl 4-[[(5R)-3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate (PubChem CID 51566662) has the molecular formula C19H17BrN2O4S and a molecular weight of 449.33 g/mol. Its IUPAC name is ethyl 4-[[(5R)-3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate.
| Compound Name | ethyl 4-[[(5R)-3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 51566662 |
| Molecular Formula | C19H17BrN2O4S |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | ethyl 4-[[(5R)-3-[(4-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N[C@@H]2SC(=O)N(Cc3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H17BrN2O4S/c1-2-26-18(24)13-5-9-15(10-6-13)21-16-17(23)22(19(25)27-16)11-12-3-7-14(20)8-4-12/h3-10,16,21H,2,11H2,1H3/t16-/m1/s1 |
| InChIKey | IOMLEDCIFHPLSG-MRXNPFEDSA-N |
| XLogP | 4.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|