C28H25BrN4O5S — CID 4249283
ethyl 4-[[2-[1-benzyl-3-[(4-bromobenzoyl)amino]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 4249283) has the molecular formula C28H25BrN4O5S and a molecular weight of 609.50 g/mol. Its IUPAC name is ethyl 4-[[2-[1-benzyl-3-[(4-bromobenzoyl)amino]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[1-benzyl-3-[(4-bromobenzoyl)amino]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4249283 |
| Molecular Formula | C28H25BrN4O5S |
| Molecular Weight | 609.50 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | ethyl 4-[[2-[1-benzyl-3-[(4-bromobenzoyl)amino]-5-oxo-2-sulfanylideneimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC2C(=O)N(Cc3ccccc3)C(=S)N2NC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C28H25BrN4O5S/c1-2-38-27(37)20-10-14-22(15-11-20)30-24(34)16-23-26(36)32(17-18-6-4-3-5-7-18)28(39)33(23)31-25(35)19-8-12-21(29)13-9-19/h3-15,23H,2,16-17H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | OVAIJYFYOAJJFX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|