C25H20BrFN4O3S — CID 4689163
N-[3-benzyl-5-[2-(3-bromoanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide (PubChem CID 4689163) has the molecular formula C25H20BrFN4O3S and a molecular weight of 555.43 g/mol. Its IUPAC name is N-[3-benzyl-5-[2-(3-bromoanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide.
| Compound Name | N-[3-benzyl-5-[2-(3-bromoanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 4689163 |
| Molecular Formula | C25H20BrFN4O3S |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | N-[3-benzyl-5-[2-(3-bromoanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-3-fluorobenzamide |
| SMILES | O=C(CC1C(=O)N(Cc2ccccc2)C(=S)N1NC(=O)c1cccc(F)c1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C25H20BrFN4O3S/c26-18-9-5-11-20(13-18)28-22(32)14-21-24(34)30(15-16-6-2-1-3-7-16)25(35)31(21)29-23(33)17-8-4-10-19(27)12-17/h1-13,21H,14-15H2,(H,28,32)(H,29,33) |
| InChIKey | HTFZPVBSRXHOMS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|