C25H21FN4O3S — CID 4099310
3-fluoro-N-[5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide (PubChem CID 4099310) has the molecular formula C25H21FN4O3S and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-fluoro-N-[5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide.
| Compound Name | 3-fluoro-N-[5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 4099310 |
| Molecular Formula | C25H21FN4O3S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-fluoro-N-[5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)CC2C(=O)N(c3ccccc3)C(=S)N2NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C25H21FN4O3S/c1-16-7-5-10-19(13-16)27-22(31)15-21-24(33)29(20-11-3-2-4-12-20)25(34)30(21)28-23(32)17-8-6-9-18(26)14-17/h2-14,21H,15H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | HNPACGWEISHTGI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|