C26H23FN4O3S — CID 19585948
N-[3-benzyl-5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide (PubChem CID 19585948) has the molecular formula C26H23FN4O3S and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[3-benzyl-5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide.
| Compound Name | N-[3-benzyl-5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 19585948 |
| Molecular Formula | C26H23FN4O3S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[3-benzyl-5-[2-(3-methylanilino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide |
| SMILES | Cc1cccc(NC(=O)CC2C(=O)N(Cc3ccccc3)C(=S)N2NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H23FN4O3S/c1-17-6-5-9-21(14-17)28-23(32)15-22-25(34)30(16-18-7-3-2-4-8-18)26(35)31(22)29-24(33)19-10-12-20(27)13-11-19/h2-14,22H,15-16H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | CZVBGWMLRQFQFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|