C15H17FN4O3S — CID 19584922
N-[3-ethyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide (PubChem CID 19584922) has the molecular formula C15H17FN4O3S and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[3-ethyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide.
| Compound Name | N-[3-ethyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 19584922 |
| Molecular Formula | C15H17FN4O3S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[3-ethyl-5-[2-(methylamino)-2-oxoethyl]-4-oxo-2-sulfanylideneimidazolidin-1-yl]-4-fluorobenzamide |
| SMILES | CCN1C(=O)C(CC(=O)NC)N(NC(=O)c2ccc(F)cc2)C1=S |
| InChI | InChI=1S/C15H17FN4O3S/c1-3-19-14(23)11(8-12(21)17-2)20(15(19)24)18-13(22)9-4-6-10(16)7-5-9/h4-7,11H,3,8H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | OTXXNVYHOQPDES-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|